About 1-amino-1,3-diethylthiourea
1-amino-1,3-diethylthiourea (PubChem CID 55286386) has the molecular formula C5H13N3S
and a molecular weight of 147.25 g/mol. Its IUPAC name is 1-amino-1,3-diethylthiourea.
Molecular Properties
| Compound Name | 1-amino-1,3-diethylthiourea |
| PubChem CID | 55286386 |
| Molecular Formula | C5H13N3S |
| Molecular Weight | 147.25 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 1-amino-1,3-diethylthiourea |
| SMILES | CCNC(=S)N(N)CC |
| InChI | InChI=1S/C5H13N3S/c1-3-7-5(9)8(6)4-2/h3-4,6H2,1-2H3,(H,7,9) |
| InChIKey | SQSHDHUEBHDEIH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-1,3-diethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-1,3-diethylthiourea?
The IUPAC name of 1-amino-1,3-diethylthiourea (CID 55286386) is 1-amino-1,3-diethylthiourea.
What is the SMILES notation for 1-amino-1,3-diethylthiourea?
The canonical SMILES for 1-amino-1,3-diethylthiourea is CCNC(=S)N(N)CC.
What is the InChIKey of 1-amino-1,3-diethylthiourea?
The InChIKey is SQSHDHUEBHDEIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3S/c1-3-7-5(9)8(6)4-2/h3-4,6H2,1-2H3,(H,7,9).
What are the key properties of 1-amino-1,3-diethylthiourea?
1-amino-1,3-diethylthiourea has a molecular weight of 147.25 g/mol, XLogP of 0.08, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-1,3-diethylthiourea is sourced from PubChem (CID 55286386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).