C10H15N — CID 55286395
1,4-dimethyl-4,5,6,7-tetrahydro-2H-isoindole (PubChem CID 55286395) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 1,4-dimethyl-4,5,6,7-tetrahydro-2H-isoindole.
| Compound Name | 1,4-dimethyl-4,5,6,7-tetrahydro-2H-isoindole |
|---|---|
| PubChem CID | 55286395 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1,4-dimethyl-4,5,6,7-tetrahydro-2H-isoindole |
| SMILES | Cc1[nH]cc2c1CCCC2C |
| InChI | InChI=1S/C10H15N/c1-7-4-3-5-9-8(2)11-6-10(7)9/h6-7,11H,3-5H2,1-2H3 |
| InChIKey | JWBFQSQBKYOIOR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |