About 2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole
2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole (PubChem CID 55286461) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 55286461 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole |
| SMILES | COC(OC)C1=NCCN1 |
| InChI | InChI=1S/C6H12N2O2/c1-9-6(10-2)5-7-3-4-8-5/h6H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | KMYBQWNCYFDMHV-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole (CID 55286461) is 2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole is COC(OC)C1=NCCN1.
What is the InChIKey of 2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole?
The InChIKey is KMYBQWNCYFDMHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-9-6(10-2)5-7-3-4-8-5/h6H,3-4H2,1-2H3,(H,7,8).
What are the key properties of 2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole?
2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole has a molecular weight of 144.17 g/mol, XLogP of -0.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethoxymethyl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 55286461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).