About (4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one
(4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one (PubChem CID 55286559) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is (4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one |
| PubChem CID | 55286559 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@H]1NC(=O)O[C@H]1C |
| InChI | InChI=1S/C6H9NO2/c1-3-5-4(2)9-6(8)7-5/h3-5H,1H2,2H3,(H,7,8)/t4-,5+/m0/s1 |
| InChIKey | OVYWWULCTFBJJW-CRCLSJGQSA-N |
| XLogP | 0.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one?
The IUPAC name of (4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one (CID 55286559) is (4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one.
What is the SMILES notation for (4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one?
The canonical SMILES for (4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one is C=C[C@H]1NC(=O)O[C@H]1C.
What is the InChIKey of (4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one?
The InChIKey is OVYWWULCTFBJJW-CRCLSJGQSA-N. The full InChI is InChI=1S/C6H9NO2/c1-3-5-4(2)9-6(8)7-5/h3-5H,1H2,2H3,(H,7,8)/t4-,5+/m0/s1.
What are the key properties of (4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one?
(4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one has a molecular weight of 127.14 g/mol, XLogP of 0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-4-ethenyl-5-methyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 55286559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).