About 4-methoxy-2-methyl-1,2-dihydropyrrol-5-one
4-methoxy-2-methyl-1,2-dihydropyrrol-5-one (PubChem CID 55286648) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 4-methoxy-2-methyl-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 4-methoxy-2-methyl-1,2-dihydropyrrol-5-one |
| PubChem CID | 55286648 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 4-methoxy-2-methyl-1,2-dihydropyrrol-5-one |
| SMILES | COC1=CC(C)NC1=O |
| InChI | InChI=1S/C6H9NO2/c1-4-3-5(9-2)6(8)7-4/h3-4H,1-2H3,(H,7,8) |
| InChIKey | OKJSNLQODXJUEI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-2-methyl-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-methyl-1,2-dihydropyrrol-5-one?
The IUPAC name of 4-methoxy-2-methyl-1,2-dihydropyrrol-5-one (CID 55286648) is 4-methoxy-2-methyl-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 4-methoxy-2-methyl-1,2-dihydropyrrol-5-one?
The canonical SMILES for 4-methoxy-2-methyl-1,2-dihydropyrrol-5-one is COC1=CC(C)NC1=O.
What is the InChIKey of 4-methoxy-2-methyl-1,2-dihydropyrrol-5-one?
The InChIKey is OKJSNLQODXJUEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-4-3-5(9-2)6(8)7-4/h3-4H,1-2H3,(H,7,8).
What are the key properties of 4-methoxy-2-methyl-1,2-dihydropyrrol-5-one?
4-methoxy-2-methyl-1,2-dihydropyrrol-5-one has a molecular weight of 127.14 g/mol, XLogP of 0.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-methyl-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 55286648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).