About 2-fluoroethyl N-ethylcarbamate
2-fluoroethyl N-ethylcarbamate (PubChem CID 55286725) has the molecular formula C5H10FNO2
and a molecular weight of 135.14 g/mol. Its IUPAC name is 2-fluoroethyl N-ethylcarbamate.
Molecular Properties
| Compound Name | 2-fluoroethyl N-ethylcarbamate |
| PubChem CID | 55286725 |
| Molecular Formula | C5H10FNO2 |
| Molecular Weight | 135.14 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2-fluoroethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCCF |
| InChI | InChI=1S/C5H10FNO2/c1-2-7-5(8)9-4-3-6/h2-4H2,1H3,(H,7,8) |
| InChIKey | SFQGYTIOZWNZSI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.14 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoroethyl N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl N-ethylcarbamate?
The IUPAC name of 2-fluoroethyl N-ethylcarbamate (CID 55286725) is 2-fluoroethyl N-ethylcarbamate.
What is the SMILES notation for 2-fluoroethyl N-ethylcarbamate?
The canonical SMILES for 2-fluoroethyl N-ethylcarbamate is CCNC(=O)OCCF.
What is the InChIKey of 2-fluoroethyl N-ethylcarbamate?
The InChIKey is SFQGYTIOZWNZSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10FNO2/c1-2-7-5(8)9-4-3-6/h2-4H2,1H3,(H,7,8).
What are the key properties of 2-fluoroethyl N-ethylcarbamate?
2-fluoroethyl N-ethylcarbamate has a molecular weight of 135.14 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl N-ethylcarbamate is sourced from PubChem (CID 55286725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).