About (4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one
(4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one (PubChem CID 55286763) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is (4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | (4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one |
| PubChem CID | 55286763 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one |
| SMILES | C=C[C@@H]1NC(=O)N[C@H]1C=C |
| InChI | InChI=1S/C7H10N2O/c1-3-5-6(4-2)9-7(10)8-5/h3-6H,1-2H2,(H2,8,9,10)/t5-,6-/m0/s1 |
| InChIKey | QRDGOLLYJREZLT-WDSKDSINSA-N |
| XLogP | 0.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one?
The IUPAC name of (4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one (CID 55286763) is (4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one.
What is the SMILES notation for (4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one?
The canonical SMILES for (4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one is C=C[C@@H]1NC(=O)N[C@H]1C=C.
What is the InChIKey of (4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one?
The InChIKey is QRDGOLLYJREZLT-WDSKDSINSA-N. The full InChI is InChI=1S/C7H10N2O/c1-3-5-6(4-2)9-7(10)8-5/h3-6H,1-2H2,(H2,8,9,10)/t5-,6-/m0/s1.
What are the key properties of (4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one?
(4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one has a molecular weight of 138.17 g/mol, XLogP of 0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4,5-bis(ethenyl)imidazolidin-2-one is sourced from PubChem (CID 55286763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).