About 2,2-diethyl-1,3-diazinane
2,2-diethyl-1,3-diazinane (PubChem CID 55286866) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is 2,2-diethyl-1,3-diazinane.
Molecular Properties
| Compound Name | 2,2-diethyl-1,3-diazinane |
| PubChem CID | 55286866 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 2,2-diethyl-1,3-diazinane |
| SMILES | CCC1(CC)NCCCN1 |
| InChI | InChI=1S/C8H18N2/c1-3-8(4-2)9-6-5-7-10-8/h9-10H,3-7H2,1-2H3 |
| InChIKey | XLTAVERHXPKANU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-diethyl-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-1,3-diazinane?
The IUPAC name of 2,2-diethyl-1,3-diazinane (CID 55286866) is 2,2-diethyl-1,3-diazinane.
What is the SMILES notation for 2,2-diethyl-1,3-diazinane?
The canonical SMILES for 2,2-diethyl-1,3-diazinane is CCC1(CC)NCCCN1.
What is the InChIKey of 2,2-diethyl-1,3-diazinane?
The InChIKey is XLTAVERHXPKANU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2/c1-3-8(4-2)9-6-5-7-10-8/h9-10H,3-7H2,1-2H3.
What are the key properties of 2,2-diethyl-1,3-diazinane?
2,2-diethyl-1,3-diazinane has a molecular weight of 142.25 g/mol, XLogP of 1.09, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-1,3-diazinane is sourced from PubChem (CID 55286866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).