About 1,3,6,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione
1,3,6,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione (PubChem CID 55286887) has the molecular formula C4H4N4O2
and a molecular weight of 140.10 g/mol. Its IUPAC name is 1,3,6,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione.
Analyze 1,3,6,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,6,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione?
The IUPAC name of 1,3,6,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione (CID 55286887) is 1,3,6,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione.
What is the SMILES notation for 1,3,6,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione?
The canonical SMILES for 1,3,6,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione is O=C1N=C2NC(=O)NC2N1.
What is the InChIKey of 1,3,6,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione?
The InChIKey is CAUVVFPBSUDVIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N4O2/c9-3-5-1-2(7-3)8-4(10)6-1/h1H,(H3,5,6,7,8,9,10).
What are the key properties of 1,3,6,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione?
1,3,6,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione has a molecular weight of 140.10 g/mol, XLogP of -1.25, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,6,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione is sourced from PubChem (CID 55286887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).