About 2-pyrrolidin-3-yl-1,3,4-oxadiazole
2-pyrrolidin-3-yl-1,3,4-oxadiazole (PubChem CID 55286899) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 2-pyrrolidin-3-yl-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-pyrrolidin-3-yl-1,3,4-oxadiazole |
| PubChem CID | 55286899 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 2-pyrrolidin-3-yl-1,3,4-oxadiazole |
| SMILES | c1nnc(C2CCNC2)o1 |
| InChI | InChI=1S/C6H9N3O/c1-2-7-3-5(1)6-9-8-4-10-6/h4-5,7H,1-3H2 |
| InChIKey | CAKHSVKNGDOJQR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyrrolidin-3-yl-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-3-yl-1,3,4-oxadiazole?
The IUPAC name of 2-pyrrolidin-3-yl-1,3,4-oxadiazole (CID 55286899) is 2-pyrrolidin-3-yl-1,3,4-oxadiazole.
What is the SMILES notation for 2-pyrrolidin-3-yl-1,3,4-oxadiazole?
The canonical SMILES for 2-pyrrolidin-3-yl-1,3,4-oxadiazole is c1nnc(C2CCNC2)o1.
What is the InChIKey of 2-pyrrolidin-3-yl-1,3,4-oxadiazole?
The InChIKey is CAKHSVKNGDOJQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c1-2-7-3-5(1)6-9-8-4-10-6/h4-5,7H,1-3H2.
What are the key properties of 2-pyrrolidin-3-yl-1,3,4-oxadiazole?
2-pyrrolidin-3-yl-1,3,4-oxadiazole has a molecular weight of 139.16 g/mol, XLogP of 0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-3-yl-1,3,4-oxadiazole is sourced from PubChem (CID 55286899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).