C6H11N3O — CID 55286934
N,5-diethyl-1,3,4-oxadiazol-2-amine (PubChem CID 55286934) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is N,5-diethyl-1,3,4-oxadiazol-2-amine.
| Compound Name | N,5-diethyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 55286934 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | N,5-diethyl-1,3,4-oxadiazol-2-amine |
| SMILES | CCNc1nnc(CC)o1 |
| InChI | InChI=1S/C6H11N3O/c1-3-5-8-9-6(10-5)7-4-2/h3-4H2,1-2H3,(H,7,9) |
| InChIKey | JPCZJKXNXYXIRO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |