About 2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane
2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane (PubChem CID 55287012) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is 2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane.
Molecular Properties
| Compound Name | 2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane |
| PubChem CID | 55287012 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane |
| SMILES | CC(C)N1C2NC21 |
| InChI | InChI=1S/C5H10N2/c1-3(2)7-4-5(7)6-4/h3-6H,1-2H3 |
| InChIKey | QTEULPQJSPOLNI-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 24.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane?
The IUPAC name of 2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane (CID 55287012) is 2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane.
What is the SMILES notation for 2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane?
The canonical SMILES for 2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane is CC(C)N1C2NC21.
What is the InChIKey of 2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane?
The InChIKey is QTEULPQJSPOLNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2/c1-3(2)7-4-5(7)6-4/h3-6H,1-2H3.
What are the key properties of 2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane?
2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane has a molecular weight of 98.15 g/mol, XLogP of -0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-2,4-diazabicyclo[1.1.0]butane is sourced from PubChem (CID 55287012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).