About 2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine
2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine (PubChem CID 55287037) has the molecular formula C7H11NS
and a molecular weight of 141.24 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine.
Analyze 2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine?
The IUPAC name of 2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine (CID 55287037) is 2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine.
What is the SMILES notation for 2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine?
The canonical SMILES for 2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine is C1CC2=C(C1)SCCN2.
What is the InChIKey of 2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine?
The InChIKey is KYJNDLSVMPHJCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS/c1-2-6-7(3-1)9-5-4-8-6/h8H,1-5H2.
What are the key properties of 2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine?
2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine has a molecular weight of 141.24 g/mol, XLogP of 1.72, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine is sourced from PubChem (CID 55287037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).