About N-methyl-1-(3-methyl-1,3-oxazolidin-5-yl)methanamine
N-methyl-1-(3-methyl-1,3-oxazolidin-5-yl)methanamine (PubChem CID 55287078) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is N-methyl-1-(3-methyl-1,3-oxazolidin-5-yl)methanamine.
Analyze N-methyl-1-(3-methyl-1,3-oxazolidin-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(3-methyl-1,3-oxazolidin-5-yl)methanamine?
The IUPAC name of N-methyl-1-(3-methyl-1,3-oxazolidin-5-yl)methanamine (CID 55287078) is N-methyl-1-(3-methyl-1,3-oxazolidin-5-yl)methanamine.
What is the SMILES notation for N-methyl-1-(3-methyl-1,3-oxazolidin-5-yl)methanamine?
The canonical SMILES for N-methyl-1-(3-methyl-1,3-oxazolidin-5-yl)methanamine is CNCC1CN(C)CO1.
What is the InChIKey of N-methyl-1-(3-methyl-1,3-oxazolidin-5-yl)methanamine?
The InChIKey is BBRYCXFTHJVEPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O/c1-7-3-6-4-8(2)5-9-6/h6-7H,3-5H2,1-2H3.
What are the key properties of N-methyl-1-(3-methyl-1,3-oxazolidin-5-yl)methanamine?
N-methyl-1-(3-methyl-1,3-oxazolidin-5-yl)methanamine has a molecular weight of 130.19 g/mol, XLogP of -0.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(3-methyl-1,3-oxazolidin-5-yl)methanamine is sourced from PubChem (CID 55287078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).