About (2S,6R)-2,6-dimethylmorpholin-3-one
(2S,6R)-2,6-dimethylmorpholin-3-one (PubChem CID 55287157) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethylmorpholin-3-one.
Molecular Properties
| Compound Name | (2S,6R)-2,6-dimethylmorpholin-3-one |
| PubChem CID | 55287157 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | (2S,6R)-2,6-dimethylmorpholin-3-one |
| SMILES | C[C@@H]1CNC(=O)[C@H](C)O1 |
| InChI | InChI=1S/C6H11NO2/c1-4-3-7-6(8)5(2)9-4/h4-5H,3H2,1-2H3,(H,7,8)/t4-,5+/m1/s1 |
| InChIKey | CJOJYCRMCKNQNN-UHNVWZDZSA-N |
| XLogP | -0.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,6R)-2,6-dimethylmorpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-2,6-dimethylmorpholin-3-one?
The IUPAC name of (2S,6R)-2,6-dimethylmorpholin-3-one (CID 55287157) is (2S,6R)-2,6-dimethylmorpholin-3-one.
What is the SMILES notation for (2S,6R)-2,6-dimethylmorpholin-3-one?
The canonical SMILES for (2S,6R)-2,6-dimethylmorpholin-3-one is C[C@@H]1CNC(=O)[C@H](C)O1.
What is the InChIKey of (2S,6R)-2,6-dimethylmorpholin-3-one?
The InChIKey is CJOJYCRMCKNQNN-UHNVWZDZSA-N. The full InChI is InChI=1S/C6H11NO2/c1-4-3-7-6(8)5(2)9-4/h4-5H,3H2,1-2H3,(H,7,8)/t4-,5+/m1/s1.
What are the key properties of (2S,6R)-2,6-dimethylmorpholin-3-one?
(2S,6R)-2,6-dimethylmorpholin-3-one has a molecular weight of 129.16 g/mol, XLogP of -0.09, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-2,6-dimethylmorpholin-3-one is sourced from PubChem (CID 55287157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).