C7H13NS — CID 55287252
3,5,6-trimethyl-3,4-dihydro-2H-1,4-thiazine (PubChem CID 55287252) has the molecular formula C7H13NS and a molecular weight of 143.25 g/mol. Its IUPAC name is 3,5,6-trimethyl-3,4-dihydro-2H-1,4-thiazine.
| Compound Name | 3,5,6-trimethyl-3,4-dihydro-2H-1,4-thiazine |
|---|---|
| PubChem CID | 55287252 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 3,5,6-trimethyl-3,4-dihydro-2H-1,4-thiazine |
| SMILES | CC1=C(C)SCC(C)N1 |
| InChI | InChI=1S/C7H13NS/c1-5-4-9-7(3)6(2)8-5/h5,8H,4H2,1-3H3 |
| InChIKey | NBRNZWNOXJGRMO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |