About 3-chloro-N-methyl-1,2,4-thiadiazol-5-amine
3-chloro-N-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 55287253) has the molecular formula C3H4ClN3S
and a molecular weight of 149.61 g/mol. Its IUPAC name is 3-chloro-N-methyl-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | 3-chloro-N-methyl-1,2,4-thiadiazol-5-amine |
| PubChem CID | 55287253 |
| Molecular Formula | C3H4ClN3S |
| Molecular Weight | 149.61 g/mol |
| Exact Mass | 148.98 |
| IUPAC Name | 3-chloro-N-methyl-1,2,4-thiadiazol-5-amine |
| SMILES | CNc1nc(Cl)ns1 |
| InChI | InChI=1S/C3H4ClN3S/c1-5-3-6-2(4)7-8-3/h1H3,(H,5,6,7) |
| InChIKey | UHZREDDUMUKMIM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.61 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-N-methyl-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-methyl-1,2,4-thiadiazol-5-amine?
The IUPAC name of 3-chloro-N-methyl-1,2,4-thiadiazol-5-amine (CID 55287253) is 3-chloro-N-methyl-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for 3-chloro-N-methyl-1,2,4-thiadiazol-5-amine?
The canonical SMILES for 3-chloro-N-methyl-1,2,4-thiadiazol-5-amine is CNc1nc(Cl)ns1.
What is the InChIKey of 3-chloro-N-methyl-1,2,4-thiadiazol-5-amine?
The InChIKey is UHZREDDUMUKMIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4ClN3S/c1-5-3-6-2(4)7-8-3/h1H3,(H,5,6,7).
What are the key properties of 3-chloro-N-methyl-1,2,4-thiadiazol-5-amine?
3-chloro-N-methyl-1,2,4-thiadiazol-5-amine has a molecular weight of 149.61 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-methyl-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 55287253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).