About 1-(2-hydroxyethyl)-1,2-dimethylguanidine
1-(2-hydroxyethyl)-1,2-dimethylguanidine (PubChem CID 55287328) has the molecular formula C5H13N3O
and a molecular weight of 131.18 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-1,2-dimethylguanidine.
Molecular Properties
| Compound Name | 1-(2-hydroxyethyl)-1,2-dimethylguanidine |
| PubChem CID | 55287328 |
| Molecular Formula | C5H13N3O |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | 1-(2-hydroxyethyl)-1,2-dimethylguanidine |
| SMILES | C/N=C(\N)N(C)CCO |
| InChI | InChI=1S/C5H13N3O/c1-7-5(6)8(2)3-4-9/h9H,3-4H2,1-2H3,(H2,6,7) |
| InChIKey | MPODHXRIXVYBBU-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxyethyl)-1,2-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyethyl)-1,2-dimethylguanidine?
The IUPAC name of 1-(2-hydroxyethyl)-1,2-dimethylguanidine (CID 55287328) is 1-(2-hydroxyethyl)-1,2-dimethylguanidine.
What is the SMILES notation for 1-(2-hydroxyethyl)-1,2-dimethylguanidine?
The canonical SMILES for 1-(2-hydroxyethyl)-1,2-dimethylguanidine is C/N=C(\N)N(C)CCO.
What is the InChIKey of 1-(2-hydroxyethyl)-1,2-dimethylguanidine?
The InChIKey is MPODHXRIXVYBBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3O/c1-7-5(6)8(2)3-4-9/h9H,3-4H2,1-2H3,(H2,6,7).
What are the key properties of 1-(2-hydroxyethyl)-1,2-dimethylguanidine?
1-(2-hydroxyethyl)-1,2-dimethylguanidine has a molecular weight of 131.18 g/mol, XLogP of -1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethyl)-1,2-dimethylguanidine is sourced from PubChem (CID 55287328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).