C7H11NO — CID 55287495
5-methyl-1,2,3,4-tetrahydroazepin-7-one (PubChem CID 55287495) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 5-methyl-1,2,3,4-tetrahydroazepin-7-one.
| Compound Name | 5-methyl-1,2,3,4-tetrahydroazepin-7-one |
|---|---|
| PubChem CID | 55287495 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 5-methyl-1,2,3,4-tetrahydroazepin-7-one |
| SMILES | CC1=CC(=O)NCCC1 |
| InChI | InChI=1S/C7H11NO/c1-6-3-2-4-8-7(9)5-6/h5H,2-4H2,1H3,(H,8,9) |
| InChIKey | RSXKVLCPJPHGFZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |