C6H11NO2 — CID 55287552
(3R,3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol (PubChem CID 55287552) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is (3R,3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol.
| Compound Name | (3R,3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol |
|---|---|
| PubChem CID | 55287552 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | (3R,3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol |
| SMILES | O[C@H]1CO[C@@H]2CCN[C@H]12 |
| InChI | InChI=1S/C6H11NO2/c8-4-3-9-5-1-2-7-6(4)5/h4-8H,1-3H2/t4-,5+,6+/m0/s1 |
| InChIKey | CDMLEMBRAYSSJQ-KVQBGUIXSA-N |
| XLogP | -0.89 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |