About 2,6-diazabicyclo[5.1.0]octa-2,4-diene
2,6-diazabicyclo[5.1.0]octa-2,4-diene (PubChem CID 55287586) has the molecular formula C6H8N2
and a molecular weight of 108.14 g/mol. Its IUPAC name is 2,6-diazabicyclo[5.1.0]octa-2,4-diene.
Molecular Properties
| Compound Name | 2,6-diazabicyclo[5.1.0]octa-2,4-diene |
| PubChem CID | 55287586 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 2,6-diazabicyclo[5.1.0]octa-2,4-diene |
| SMILES | C1=CNC2CC2N=C1 |
| InChI | InChI=1S/C6H8N2/c1-2-7-5-4-6(5)8-3-1/h1-3,5-7H,4H2 |
| InChIKey | BWFKEZVZUXYPKS-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-diazabicyclo[5.1.0]octa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diazabicyclo[5.1.0]octa-2,4-diene?
The IUPAC name of 2,6-diazabicyclo[5.1.0]octa-2,4-diene (CID 55287586) is 2,6-diazabicyclo[5.1.0]octa-2,4-diene.
What is the SMILES notation for 2,6-diazabicyclo[5.1.0]octa-2,4-diene?
The canonical SMILES for 2,6-diazabicyclo[5.1.0]octa-2,4-diene is C1=CNC2CC2N=C1.
What is the InChIKey of 2,6-diazabicyclo[5.1.0]octa-2,4-diene?
The InChIKey is BWFKEZVZUXYPKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2/c1-2-7-5-4-6(5)8-3-1/h1-3,5-7H,4H2.
What are the key properties of 2,6-diazabicyclo[5.1.0]octa-2,4-diene?
2,6-diazabicyclo[5.1.0]octa-2,4-diene has a molecular weight of 108.14 g/mol, XLogP of 0.31, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diazabicyclo[5.1.0]octa-2,4-diene is sourced from PubChem (CID 55287586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).