About 5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine
5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine (PubChem CID 55287759) has the molecular formula C6H11NS
and a molecular weight of 129.23 g/mol. Its IUPAC name is 5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine.
Molecular Properties
| Compound Name | 5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine |
| PubChem CID | 55287759 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine |
| SMILES | CC1=C(C)SCCN1 |
| InChI | InChI=1S/C6H11NS/c1-5-6(2)8-4-3-7-5/h7H,3-4H2,1-2H3 |
| InChIKey | WRIRPWYJLBOOEZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine?
The IUPAC name of 5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine (CID 55287759) is 5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine.
What is the SMILES notation for 5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine?
The canonical SMILES for 5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine is CC1=C(C)SCCN1.
What is the InChIKey of 5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine?
The InChIKey is WRIRPWYJLBOOEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NS/c1-5-6(2)8-4-3-7-5/h7H,3-4H2,1-2H3.
What are the key properties of 5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine?
5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine has a molecular weight of 129.23 g/mol, XLogP of 1.57, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-3,4-dihydro-2H-1,4-thiazine is sourced from PubChem (CID 55287759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).