About (1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine
(1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine (PubChem CID 55287826) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is (1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine.
Molecular Properties
| Compound Name | (1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine |
| PubChem CID | 55287826 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine |
| SMILES | CN(C)C1[C@H]2CNC[C@@H]12 |
| InChI | InChI=1S/C7H14N2/c1-9(2)7-5-3-8-4-6(5)7/h5-8H,3-4H2,1-2H3/t5-,6+,7? |
| InChIKey | OJQACUULHAUXBI-MEKDEQNOSA-N |
| XLogP | -0.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine?
The IUPAC name of (1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine (CID 55287826) is (1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine.
What is the SMILES notation for (1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine?
The canonical SMILES for (1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine is CN(C)C1[C@H]2CNC[C@@H]12.
What is the InChIKey of (1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine?
The InChIKey is OJQACUULHAUXBI-MEKDEQNOSA-N. The full InChI is InChI=1S/C7H14N2/c1-9(2)7-5-3-8-4-6(5)7/h5-8H,3-4H2,1-2H3/t5-,6+,7?.
What are the key properties of (1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine?
(1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine has a molecular weight of 126.20 g/mol, XLogP of -0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-6-amine is sourced from PubChem (CID 55287826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).