About 2-methyl-4H-furo[3,2-b]pyrrole
2-methyl-4H-furo[3,2-b]pyrrole (PubChem CID 55287881) has the molecular formula C7H7NO
and a molecular weight of 121.14 g/mol. Its IUPAC name is 2-methyl-4H-furo[3,2-b]pyrrole.
Molecular Properties
| Compound Name | 2-methyl-4H-furo[3,2-b]pyrrole |
| PubChem CID | 55287881 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | 2-methyl-4H-furo[3,2-b]pyrrole |
| SMILES | Cc1cc2[nH]ccc2o1 |
| InChI | InChI=1S/C7H7NO/c1-5-4-6-7(9-5)2-3-8-6/h2-4,8H,1H3 |
| InChIKey | GJTQPOHJEMAGIX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-4H-furo[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4H-furo[3,2-b]pyrrole?
The IUPAC name of 2-methyl-4H-furo[3,2-b]pyrrole (CID 55287881) is 2-methyl-4H-furo[3,2-b]pyrrole.
What is the SMILES notation for 2-methyl-4H-furo[3,2-b]pyrrole?
The canonical SMILES for 2-methyl-4H-furo[3,2-b]pyrrole is Cc1cc2[nH]ccc2o1.
What is the InChIKey of 2-methyl-4H-furo[3,2-b]pyrrole?
The InChIKey is GJTQPOHJEMAGIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO/c1-5-4-6-7(9-5)2-3-8-6/h2-4,8H,1H3.
What are the key properties of 2-methyl-4H-furo[3,2-b]pyrrole?
2-methyl-4H-furo[3,2-b]pyrrole has a molecular weight of 121.14 g/mol, XLogP of 2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4H-furo[3,2-b]pyrrole is sourced from PubChem (CID 55287881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).