About 1-(3-hydroxypropyl)-1,3-dimethylurea
1-(3-hydroxypropyl)-1,3-dimethylurea (PubChem CID 55287953) has the molecular formula C6H14N2O2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-(3-hydroxypropyl)-1,3-dimethylurea |
| PubChem CID | 55287953 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 1-(3-hydroxypropyl)-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)CCCO |
| InChI | InChI=1S/C6H14N2O2/c1-7-6(10)8(2)4-3-5-9/h9H,3-5H2,1-2H3,(H,7,10) |
| InChIKey | QEDPOBBPBCBZNF-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-hydroxypropyl)-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-hydroxypropyl)-1,3-dimethylurea?
The IUPAC name of 1-(3-hydroxypropyl)-1,3-dimethylurea (CID 55287953) is 1-(3-hydroxypropyl)-1,3-dimethylurea.
What is the SMILES notation for 1-(3-hydroxypropyl)-1,3-dimethylurea?
The canonical SMILES for 1-(3-hydroxypropyl)-1,3-dimethylurea is CNC(=O)N(C)CCCO.
What is the InChIKey of 1-(3-hydroxypropyl)-1,3-dimethylurea?
The InChIKey is QEDPOBBPBCBZNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O2/c1-7-6(10)8(2)4-3-5-9/h9H,3-5H2,1-2H3,(H,7,10).
What are the key properties of 1-(3-hydroxypropyl)-1,3-dimethylurea?
1-(3-hydroxypropyl)-1,3-dimethylurea has a molecular weight of 146.19 g/mol, XLogP of -0.36, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-hydroxypropyl)-1,3-dimethylurea is sourced from PubChem (CID 55287953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).