About 1H-furo[3,4-b]pyrrole
1H-furo[3,4-b]pyrrole (PubChem CID 55288078) has the molecular formula C6H5NO
and a molecular weight of 107.11 g/mol. Its IUPAC name is 1H-furo[3,4-b]pyrrole.
Molecular Properties
| Compound Name | 1H-furo[3,4-b]pyrrole |
| PubChem CID | 55288078 |
| Molecular Formula | C6H5NO |
| Molecular Weight | 107.11 g/mol |
| Exact Mass | 107.04 |
| IUPAC Name | 1H-furo[3,4-b]pyrrole |
| SMILES | c1cc2cocc2[nH]1 |
| InChI | InChI=1S/C6H5NO/c1-2-7-6-4-8-3-5(1)6/h1-4,7H |
| InChIKey | QMRGYLXQIVLGHR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.11 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-furo[3,4-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-furo[3,4-b]pyrrole?
The IUPAC name of 1H-furo[3,4-b]pyrrole (CID 55288078) is 1H-furo[3,4-b]pyrrole.
What is the SMILES notation for 1H-furo[3,4-b]pyrrole?
The canonical SMILES for 1H-furo[3,4-b]pyrrole is c1cc2cocc2[nH]1.
What is the InChIKey of 1H-furo[3,4-b]pyrrole?
The InChIKey is QMRGYLXQIVLGHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO/c1-2-7-6-4-8-3-5(1)6/h1-4,7H.
What are the key properties of 1H-furo[3,4-b]pyrrole?
1H-furo[3,4-b]pyrrole has a molecular weight of 107.11 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-furo[3,4-b]pyrrole is sourced from PubChem (CID 55288078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).