About 2,2-dimethyl-1,3-oxazolidin-5-one
2,2-dimethyl-1,3-oxazolidin-5-one (PubChem CID 55288080) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-oxazolidin-5-one.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,3-oxazolidin-5-one |
| PubChem CID | 55288080 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | 2,2-dimethyl-1,3-oxazolidin-5-one |
| SMILES | CC1(C)NCC(=O)O1 |
| InChI | InChI=1S/C5H9NO2/c1-5(2)6-3-4(7)8-5/h6H,3H2,1-2H3 |
| InChIKey | DEVNADNRGSAWAY-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-1,3-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,3-oxazolidin-5-one?
The IUPAC name of 2,2-dimethyl-1,3-oxazolidin-5-one (CID 55288080) is 2,2-dimethyl-1,3-oxazolidin-5-one.
What is the SMILES notation for 2,2-dimethyl-1,3-oxazolidin-5-one?
The canonical SMILES for 2,2-dimethyl-1,3-oxazolidin-5-one is CC1(C)NCC(=O)O1.
What is the InChIKey of 2,2-dimethyl-1,3-oxazolidin-5-one?
The InChIKey is DEVNADNRGSAWAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2/c1-5(2)6-3-4(7)8-5/h6H,3H2,1-2H3.
What are the key properties of 2,2-dimethyl-1,3-oxazolidin-5-one?
2,2-dimethyl-1,3-oxazolidin-5-one has a molecular weight of 115.13 g/mol, XLogP of -0.13, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,3-oxazolidin-5-one is sourced from PubChem (CID 55288080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).