About 1-(2-hydroxyethyl)-1,3-diazinan-2-one
1-(2-hydroxyethyl)-1,3-diazinan-2-one (PubChem CID 55288148) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-(2-hydroxyethyl)-1,3-diazinan-2-one |
| PubChem CID | 55288148 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 1-(2-hydroxyethyl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1CCO |
| InChI | InChI=1S/C6H12N2O2/c9-5-4-8-3-1-2-7-6(8)10/h9H,1-5H2,(H,7,10) |
| InChIKey | SNUUBCVNJIAAML-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-hydroxyethyl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyethyl)-1,3-diazinan-2-one?
The IUPAC name of 1-(2-hydroxyethyl)-1,3-diazinan-2-one (CID 55288148) is 1-(2-hydroxyethyl)-1,3-diazinan-2-one.
What is the SMILES notation for 1-(2-hydroxyethyl)-1,3-diazinan-2-one?
The canonical SMILES for 1-(2-hydroxyethyl)-1,3-diazinan-2-one is O=C1NCCCN1CCO.
What is the InChIKey of 1-(2-hydroxyethyl)-1,3-diazinan-2-one?
The InChIKey is SNUUBCVNJIAAML-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c9-5-4-8-3-1-2-7-6(8)10/h9H,1-5H2,(H,7,10).
What are the key properties of 1-(2-hydroxyethyl)-1,3-diazinan-2-one?
1-(2-hydroxyethyl)-1,3-diazinan-2-one has a molecular weight of 144.17 g/mol, XLogP of -0.61, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethyl)-1,3-diazinan-2-one is sourced from PubChem (CID 55288148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).