2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid

C5H6N2O3 — CID 55288152

IUPAC2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid
SMILESO=C1NC=C(C(=O)O)CN1
InChIInChI=1S/C5H6N2O3/c8-4(9)3-1-6-5(10)7-2-3/h1H,2H2,(H,8,9)(H2,6,7,10)
InChIKeyKPWFWZDRAWODMR-UHFFFAOYSA-N
MW142.11 g/mol
LogP-0.73
Rot. Bonds1

About 2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid

2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid (PubChem CID 55288152) has the molecular formula C5H6N2O3 and a molecular weight of 142.11 g/mol. Its IUPAC name is 2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid.

Molecular Properties

Compound Name2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid
PubChem CID55288152
Molecular FormulaC5H6N2O3
Molecular Weight142.11 g/mol
Exact Mass142.04
IUPAC Name2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid
SMILESO=C1NC=C(C(=O)O)CN1
InChIInChI=1S/C5H6N2O3/c8-4(9)3-1-6-5(10)7-2-3/h1H,2H2,(H,8,9)(H2,6,7,10)
InChIKeyKPWFWZDRAWODMR-UHFFFAOYSA-N
XLogP-0.73
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.11
LogP ≤ 5-0.73
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid?
The IUPAC name of 2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid (CID 55288152) is 2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid.
What is the SMILES notation for 2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid?
The canonical SMILES for 2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid is O=C1NC=C(C(=O)O)CN1.
What is the InChIKey of 2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid?
The InChIKey is KPWFWZDRAWODMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3/c8-4(9)3-1-6-5(10)7-2-3/h1H,2H2,(H,8,9)(H2,6,7,10).
What are the key properties of 2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid?
2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid has a molecular weight of 142.11 g/mol, XLogP of -0.73, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylic acid is sourced from PubChem (CID 55288152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).