C7H12N2O — CID 55288177
N-(4-ethenyl-2,3,4,5-tetrahydropyridin-6-yl)hydroxylamine (PubChem CID 55288177) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is N-(4-ethenyl-2,3,4,5-tetrahydropyridin-6-yl)hydroxylamine.
| Compound Name | N-(4-ethenyl-2,3,4,5-tetrahydropyridin-6-yl)hydroxylamine |
|---|---|
| PubChem CID | 55288177 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | N-(4-ethenyl-2,3,4,5-tetrahydropyridin-6-yl)hydroxylamine |
| SMILES | C=CC1CCN=C(NO)C1 |
| InChI | InChI=1S/C7H12N2O/c1-2-6-3-4-8-7(5-6)9-10/h2,6,10H,1,3-5H2,(H,8,9) |
| InChIKey | XEVPDKQJHRCOGC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|