About 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one
5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one (PubChem CID 55288246) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one.
Molecular Properties
| Compound Name | 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one |
| PubChem CID | 55288246 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one |
| SMILES | CC1=CC(=O)OCCN1 |
| InChI | InChI=1S/C6H9NO2/c1-5-4-6(8)9-3-2-7-5/h4,7H,2-3H2,1H3 |
| InChIKey | PDBXABYMCYHUCK-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one?
The IUPAC name of 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one (CID 55288246) is 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one.
What is the SMILES notation for 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one?
The canonical SMILES for 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one is CC1=CC(=O)OCCN1.
What is the InChIKey of 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one?
The InChIKey is PDBXABYMCYHUCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-5-4-6(8)9-3-2-7-5/h4,7H,2-3H2,1H3.
What are the key properties of 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one?
5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one has a molecular weight of 127.14 g/mol, XLogP of 0.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one is sourced from PubChem (CID 55288246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).