C6H9NO2 — CID 55288246
5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one (PubChem CID 55288246) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one.
| Compound Name | 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one |
|---|---|
| PubChem CID | 55288246 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 5-methyl-3,4-dihydro-2H-1,4-oxazepin-7-one |
| SMILES | CC1=CC(=O)OCCN1 |
| InChI | InChI=1S/C6H9NO2/c1-5-4-6(8)9-3-2-7-5/h4,7H,2-3H2,1H3 |
| InChIKey | PDBXABYMCYHUCK-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |