About 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile
2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile (PubChem CID 55288379) has the molecular formula C5H4N2O3
and a molecular weight of 140.10 g/mol. Its IUPAC name is 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile |
| PubChem CID | 55288379 |
| Molecular Formula | C5H4N2O3 |
| Molecular Weight | 140.10 g/mol |
| Exact Mass | 140.02 |
| IUPAC Name | 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile |
| SMILES | N#CC[C@@H]1NC(=O)OC1=O |
| InChI | InChI=1S/C5H4N2O3/c6-2-1-3-4(8)10-5(9)7-3/h3H,1H2,(H,7,9)/t3-/m0/s1 |
| InChIKey | OKSQUMMTPOILBI-VKHMYHEASA-N |
| XLogP | -0.46 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.10 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile?
The IUPAC name of 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile (CID 55288379) is 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile.
What is the SMILES notation for 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile?
The canonical SMILES for 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile is N#CC[C@@H]1NC(=O)OC1=O.
What is the InChIKey of 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile?
The InChIKey is OKSQUMMTPOILBI-VKHMYHEASA-N. The full InChI is InChI=1S/C5H4N2O3/c6-2-1-3-4(8)10-5(9)7-3/h3H,1H2,(H,7,9)/t3-/m0/s1.
What are the key properties of 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile?
2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile has a molecular weight of 140.10 g/mol, XLogP of -0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetonitrile is sourced from PubChem (CID 55288379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).