About 1-methylimidazole-4,5-diamine;hydrochloride
1-methylimidazole-4,5-diamine;hydrochloride (PubChem CID 55288566) has the molecular formula C4H9ClN4
and a molecular weight of 148.60 g/mol. Its IUPAC name is 1-methylimidazole-4,5-diamine;hydrochloride.
Molecular Properties
| Compound Name | 1-methylimidazole-4,5-diamine;hydrochloride |
| PubChem CID | 55288566 |
| Molecular Formula | C4H9ClN4 |
| Molecular Weight | 148.60 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 1-methylimidazole-4,5-diamine;hydrochloride |
| SMILES | Cl.Cn1cnc(N)c1N |
| InChI | InChI=1S/C4H8N4.ClH/c1-8-2-7-3(5)4(8)6;/h2H,5-6H2,1H3;1H |
| InChIKey | LCXCTEMNVJKOBN-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.60 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylimidazole-4,5-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylimidazole-4,5-diamine;hydrochloride?
The IUPAC name of 1-methylimidazole-4,5-diamine;hydrochloride (CID 55288566) is 1-methylimidazole-4,5-diamine;hydrochloride.
What is the SMILES notation for 1-methylimidazole-4,5-diamine;hydrochloride?
The canonical SMILES for 1-methylimidazole-4,5-diamine;hydrochloride is Cl.Cn1cnc(N)c1N.
What is the InChIKey of 1-methylimidazole-4,5-diamine;hydrochloride?
The InChIKey is LCXCTEMNVJKOBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4.ClH/c1-8-2-7-3(5)4(8)6;/h2H,5-6H2,1H3;1H.
What are the key properties of 1-methylimidazole-4,5-diamine;hydrochloride?
1-methylimidazole-4,5-diamine;hydrochloride has a molecular weight of 148.60 g/mol, XLogP of 0.01, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylimidazole-4,5-diamine;hydrochloride is sourced from PubChem (CID 55288566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).