About 3-ethenoxypropylurea
3-ethenoxypropylurea (PubChem CID 55288672) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 3-ethenoxypropylurea.
Molecular Properties
| Compound Name | 3-ethenoxypropylurea |
| PubChem CID | 55288672 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 3-ethenoxypropylurea |
| SMILES | C=COCCCNC(N)=O |
| InChI | InChI=1S/C6H12N2O2/c1-2-10-5-3-4-8-6(7)9/h2H,1,3-5H2,(H3,7,8,9) |
| InChIKey | BPAZCWSPOCHLKP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenoxypropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenoxypropylurea?
The IUPAC name of 3-ethenoxypropylurea (CID 55288672) is 3-ethenoxypropylurea.
What is the SMILES notation for 3-ethenoxypropylurea?
The canonical SMILES for 3-ethenoxypropylurea is C=COCCCNC(N)=O.
What is the InChIKey of 3-ethenoxypropylurea?
The InChIKey is BPAZCWSPOCHLKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-2-10-5-3-4-8-6(7)9/h2H,1,3-5H2,(H3,7,8,9).
What are the key properties of 3-ethenoxypropylurea?
3-ethenoxypropylurea has a molecular weight of 144.17 g/mol, XLogP of 0.20, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenoxypropylurea is sourced from PubChem (CID 55288672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).