About (2-methoxycyclohexa-2,5-dien-1-yl)methanamine
(2-methoxycyclohexa-2,5-dien-1-yl)methanamine (PubChem CID 55288691) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is (2-methoxycyclohexa-2,5-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | (2-methoxycyclohexa-2,5-dien-1-yl)methanamine |
| PubChem CID | 55288691 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (2-methoxycyclohexa-2,5-dien-1-yl)methanamine |
| SMILES | COC1=CCC=CC1CN |
| InChI | InChI=1S/C8H13NO/c1-10-8-5-3-2-4-7(8)6-9/h2,4-5,7H,3,6,9H2,1H3 |
| InChIKey | NGPFWZZJDFDYKS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxycyclohexa-2,5-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxycyclohexa-2,5-dien-1-yl)methanamine?
The IUPAC name of (2-methoxycyclohexa-2,5-dien-1-yl)methanamine (CID 55288691) is (2-methoxycyclohexa-2,5-dien-1-yl)methanamine.
What is the SMILES notation for (2-methoxycyclohexa-2,5-dien-1-yl)methanamine?
The canonical SMILES for (2-methoxycyclohexa-2,5-dien-1-yl)methanamine is COC1=CCC=CC1CN.
What is the InChIKey of (2-methoxycyclohexa-2,5-dien-1-yl)methanamine?
The InChIKey is NGPFWZZJDFDYKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-10-8-5-3-2-4-7(8)6-9/h2,4-5,7H,3,6,9H2,1H3.
What are the key properties of (2-methoxycyclohexa-2,5-dien-1-yl)methanamine?
(2-methoxycyclohexa-2,5-dien-1-yl)methanamine has a molecular weight of 139.20 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxycyclohexa-2,5-dien-1-yl)methanamine is sourced from PubChem (CID 55288691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).