About ethylthiourea
ethylthiourea (PubChem CID 55288796) has the molecular formula C3H8N2S
and a molecular weight of 107.08 g/mol. Its IUPAC name is ethylthiourea.
Molecular Properties
| Compound Name | ethylthiourea |
| PubChem CID | 55288796 |
| Molecular Formula | C3H8N2S |
| Molecular Weight | 107.08 g/mol |
| Exact Mass | 107.04 |
| IUPAC Name | ethylthiourea |
| SMILES | CCNC(N)=[35S] |
| InChI | InChI=1S/C3H8N2S/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6)/i6+3 |
| InChIKey | GMEHFXXZSWDEDB-TZQHSVHGSA-N |
| XLogP | -0.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.08 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylthiourea?
The IUPAC name of ethylthiourea (CID 55288796) is ethylthiourea.
What is the SMILES notation for ethylthiourea?
The canonical SMILES for ethylthiourea is CCNC(N)=[35S].
What is the InChIKey of ethylthiourea?
The InChIKey is GMEHFXXZSWDEDB-TZQHSVHGSA-N. The full InChI is InChI=1S/C3H8N2S/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6)/i6+3.
What are the key properties of ethylthiourea?
ethylthiourea has a molecular weight of 107.08 g/mol, XLogP of -0.16, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylthiourea is sourced from PubChem (CID 55288796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).