About 2-nitropentan-1-amine
2-nitropentan-1-amine (PubChem CID 55288886) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is 2-nitropentan-1-amine.
Molecular Properties
| Compound Name | 2-nitropentan-1-amine |
| PubChem CID | 55288886 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 2-nitropentan-1-amine |
| SMILES | CCCC(CN)[N+](=O)[O-] |
| InChI | InChI=1S/C5H12N2O2/c1-2-3-5(4-6)7(8)9/h5H,2-4,6H2,1H3 |
| InChIKey | JQXMRBRERHCSSZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitropentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitropentan-1-amine?
The IUPAC name of 2-nitropentan-1-amine (CID 55288886) is 2-nitropentan-1-amine.
What is the SMILES notation for 2-nitropentan-1-amine?
The canonical SMILES for 2-nitropentan-1-amine is CCCC(CN)[N+](=O)[O-].
What is the InChIKey of 2-nitropentan-1-amine?
The InChIKey is JQXMRBRERHCSSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2/c1-2-3-5(4-6)7(8)9/h5H,2-4,6H2,1H3.
What are the key properties of 2-nitropentan-1-amine?
2-nitropentan-1-amine has a molecular weight of 132.16 g/mol, XLogP of 0.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitropentan-1-amine is sourced from PubChem (CID 55288886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).