About (3-methyl-1,2-thiazol-5-yl)methanamine
(3-methyl-1,2-thiazol-5-yl)methanamine (PubChem CID 55289034) has the molecular formula C5H8N2S
and a molecular weight of 128.20 g/mol. Its IUPAC name is (3-methyl-1,2-thiazol-5-yl)methanamine.
Molecular Properties
| Compound Name | (3-methyl-1,2-thiazol-5-yl)methanamine |
| PubChem CID | 55289034 |
| Molecular Formula | C5H8N2S |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | (3-methyl-1,2-thiazol-5-yl)methanamine |
| SMILES | Cc1cc(CN)sn1 |
| InChI | InChI=1S/C5H8N2S/c1-4-2-5(3-6)8-7-4/h2H,3,6H2,1H3 |
| InChIKey | DURCPGVQMXNQJC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methyl-1,2-thiazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,2-thiazol-5-yl)methanamine?
The IUPAC name of (3-methyl-1,2-thiazol-5-yl)methanamine (CID 55289034) is (3-methyl-1,2-thiazol-5-yl)methanamine.
What is the SMILES notation for (3-methyl-1,2-thiazol-5-yl)methanamine?
The canonical SMILES for (3-methyl-1,2-thiazol-5-yl)methanamine is Cc1cc(CN)sn1.
What is the InChIKey of (3-methyl-1,2-thiazol-5-yl)methanamine?
The InChIKey is DURCPGVQMXNQJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2S/c1-4-2-5(3-6)8-7-4/h2H,3,6H2,1H3.
What are the key properties of (3-methyl-1,2-thiazol-5-yl)methanamine?
(3-methyl-1,2-thiazol-5-yl)methanamine has a molecular weight of 128.20 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,2-thiazol-5-yl)methanamine is sourced from PubChem (CID 55289034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).