C9H19N — CID 55289191
(3R)-3-propan-2-ylcyclohexan-1-amine (PubChem CID 55289191) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is (3R)-3-propan-2-ylcyclohexan-1-amine.
| Compound Name | (3R)-3-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 55289191 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (3R)-3-propan-2-ylcyclohexan-1-amine |
| SMILES | CC(C)[C@@H]1CCCC(N)C1 |
| InChI | InChI=1S/C9H19N/c1-7(2)8-4-3-5-9(10)6-8/h7-9H,3-6,10H2,1-2H3/t8-,9?/m1/s1 |
| InChIKey | LTCDIKCILSGJJD-VEDVMXKPSA-N |
| XLogP | 2.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |