About 2-(5-methyl-1,2-oxazol-4-yl)ethanamine
2-(5-methyl-1,2-oxazol-4-yl)ethanamine (PubChem CID 55289444) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 2-(5-methyl-1,2-oxazol-4-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(5-methyl-1,2-oxazol-4-yl)ethanamine |
| PubChem CID | 55289444 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 2-(5-methyl-1,2-oxazol-4-yl)ethanamine |
| SMILES | Cc1oncc1CCN |
| InChI | InChI=1S/C6H10N2O/c1-5-6(2-3-7)4-8-9-5/h4H,2-3,7H2,1H3 |
| InChIKey | DUMQMTCCFYLBSK-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-methyl-1,2-oxazol-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-1,2-oxazol-4-yl)ethanamine?
The IUPAC name of 2-(5-methyl-1,2-oxazol-4-yl)ethanamine (CID 55289444) is 2-(5-methyl-1,2-oxazol-4-yl)ethanamine.
What is the SMILES notation for 2-(5-methyl-1,2-oxazol-4-yl)ethanamine?
The canonical SMILES for 2-(5-methyl-1,2-oxazol-4-yl)ethanamine is Cc1oncc1CCN.
What is the InChIKey of 2-(5-methyl-1,2-oxazol-4-yl)ethanamine?
The InChIKey is DUMQMTCCFYLBSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-5-6(2-3-7)4-8-9-5/h4H,2-3,7H2,1H3.
What are the key properties of 2-(5-methyl-1,2-oxazol-4-yl)ethanamine?
2-(5-methyl-1,2-oxazol-4-yl)ethanamine has a molecular weight of 126.16 g/mol, XLogP of 0.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-1,2-oxazol-4-yl)ethanamine is sourced from PubChem (CID 55289444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).