About 2-propyliminopropanamide
2-propyliminopropanamide (PubChem CID 55289564) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is 2-propyliminopropanamide.
Molecular Properties
| Compound Name | 2-propyliminopropanamide |
| PubChem CID | 55289564 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 2-propyliminopropanamide |
| SMILES | CCC/N=C(\C)C(N)=O |
| InChI | InChI=1S/C6H12N2O/c1-3-4-8-5(2)6(7)9/h3-4H2,1-2H3,(H2,7,9)/b8-5+ |
| InChIKey | WKUAPIFCZMIUIP-VMPITWQZSA-N |
| XLogP | 0.34 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-propyliminopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyliminopropanamide?
The IUPAC name of 2-propyliminopropanamide (CID 55289564) is 2-propyliminopropanamide.
What is the SMILES notation for 2-propyliminopropanamide?
The canonical SMILES for 2-propyliminopropanamide is CCC/N=C(\C)C(N)=O.
What is the InChIKey of 2-propyliminopropanamide?
The InChIKey is WKUAPIFCZMIUIP-VMPITWQZSA-N. The full InChI is InChI=1S/C6H12N2O/c1-3-4-8-5(2)6(7)9/h3-4H2,1-2H3,(H2,7,9)/b8-5+.
What are the key properties of 2-propyliminopropanamide?
2-propyliminopropanamide has a molecular weight of 128.17 g/mol, XLogP of 0.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyliminopropanamide is sourced from PubChem (CID 55289564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).