About (E)-hex-3-en-2-amine;hydrochloride
(E)-hex-3-en-2-amine;hydrochloride (PubChem CID 55289622) has the molecular formula C6H14ClN
and a molecular weight of 135.64 g/mol. Its IUPAC name is (E)-hex-3-en-2-amine;hydrochloride.
Molecular Properties
| Compound Name | (E)-hex-3-en-2-amine;hydrochloride |
| PubChem CID | 55289622 |
| Molecular Formula | C6H14ClN |
| Molecular Weight | 135.64 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | (E)-hex-3-en-2-amine;hydrochloride |
| SMILES | CC/C=C/C(C)N.Cl |
| InChI | InChI=1S/C6H13N.ClH/c1-3-4-5-6(2)7;/h4-6H,3,7H2,1-2H3;1H/b5-4+; |
| InChIKey | URRCCSCOHTUGNY-FXRZFVDSSA-N |
| XLogP | 1.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.64 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-hex-3-en-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-hex-3-en-2-amine;hydrochloride?
The IUPAC name of (E)-hex-3-en-2-amine;hydrochloride (CID 55289622) is (E)-hex-3-en-2-amine;hydrochloride.
What is the SMILES notation for (E)-hex-3-en-2-amine;hydrochloride?
The canonical SMILES for (E)-hex-3-en-2-amine;hydrochloride is CC/C=C/C(C)N.Cl.
What is the InChIKey of (E)-hex-3-en-2-amine;hydrochloride?
The InChIKey is URRCCSCOHTUGNY-FXRZFVDSSA-N. The full InChI is InChI=1S/C6H13N.ClH/c1-3-4-5-6(2)7;/h4-6H,3,7H2,1-2H3;1H/b5-4+;.
What are the key properties of (E)-hex-3-en-2-amine;hydrochloride?
(E)-hex-3-en-2-amine;hydrochloride has a molecular weight of 135.64 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-hex-3-en-2-amine;hydrochloride is sourced from PubChem (CID 55289622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).