C8H15N — CID 55289732
[(1R,2S)-2-methylcyclohex-3-en-1-yl]methanamine (PubChem CID 55289732) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is [(1R,2S)-2-methylcyclohex-3-en-1-yl]methanamine.
| Compound Name | [(1R,2S)-2-methylcyclohex-3-en-1-yl]methanamine |
|---|---|
| PubChem CID | 55289732 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | [(1R,2S)-2-methylcyclohex-3-en-1-yl]methanamine |
| SMILES | C[C@H]1C=CCC[C@H]1CN |
| InChI | InChI=1S/C8H15N/c1-7-4-2-3-5-8(7)6-9/h2,4,7-8H,3,5-6,9H2,1H3/t7-,8-/m0/s1 |
| InChIKey | UPDCBFHWIDJHDF-YUMQZZPRSA-N |
| XLogP | 1.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|