C9H11NO — CID 55289737
2-amino-4,7-dimethylcyclohepta-2,4,6-trien-1-one (PubChem CID 55289737) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-amino-4,7-dimethylcyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-amino-4,7-dimethylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 55289737 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 2-amino-4,7-dimethylcyclohepta-2,4,6-trien-1-one |
| SMILES | Cc1ccc(C)c(=O)c(N)c1 |
| InChI | InChI=1S/C9H11NO/c1-6-3-4-7(2)9(11)8(10)5-6/h3-5H,1-2H3,(H2,10,11) |
| InChIKey | UIGPWNATXKGWRT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |