About imidazo[1,2-a]pyridin-7-ylmethanamine
imidazo[1,2-a]pyridin-7-ylmethanamine (PubChem CID 55289825) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-7-ylmethanamine.
Molecular Properties
| Compound Name | imidazo[1,2-a]pyridin-7-ylmethanamine |
| PubChem CID | 55289825 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | imidazo[1,2-a]pyridin-7-ylmethanamine |
| SMILES | NCc1ccn2ccnc2c1 |
| InChI | InChI=1S/C8H9N3/c9-6-7-1-3-11-4-2-10-8(11)5-7/h1-5H,6,9H2 |
| InChIKey | JOQDUOWWWPMEHJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imidazo[1,2-a]pyridin-7-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-a]pyridin-7-ylmethanamine?
The IUPAC name of imidazo[1,2-a]pyridin-7-ylmethanamine (CID 55289825) is imidazo[1,2-a]pyridin-7-ylmethanamine.
What is the SMILES notation for imidazo[1,2-a]pyridin-7-ylmethanamine?
The canonical SMILES for imidazo[1,2-a]pyridin-7-ylmethanamine is NCc1ccn2ccnc2c1.
What is the InChIKey of imidazo[1,2-a]pyridin-7-ylmethanamine?
The InChIKey is JOQDUOWWWPMEHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c9-6-7-1-3-11-4-2-10-8(11)5-7/h1-5H,6,9H2.
What are the key properties of imidazo[1,2-a]pyridin-7-ylmethanamine?
imidazo[1,2-a]pyridin-7-ylmethanamine has a molecular weight of 147.18 g/mol, XLogP of 0.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-a]pyridin-7-ylmethanamine is sourced from PubChem (CID 55289825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).