About 2,3-diiminobutanamide
2,3-diiminobutanamide (PubChem CID 55289896) has the molecular formula C4H7N3O
and a molecular weight of 113.12 g/mol. Its IUPAC name is 2,3-diiminobutanamide.
Molecular Properties
| Compound Name | 2,3-diiminobutanamide |
| PubChem CID | 55289896 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 2,3-diiminobutanamide |
| SMILES | [H]/N=C(C)/C(=N\[H])C(N)=O |
| InChI | InChI=1S/C4H7N3O/c1-2(5)3(6)4(7)8/h5-6H,1H3,(H2,7,8)/b5-2+,6-3+ |
| InChIKey | NTQJFJPBXPVGNI-BUSIMMOISA-N |
| XLogP | -0.47 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diiminobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diiminobutanamide?
The IUPAC name of 2,3-diiminobutanamide (CID 55289896) is 2,3-diiminobutanamide.
What is the SMILES notation for 2,3-diiminobutanamide?
The canonical SMILES for 2,3-diiminobutanamide is [H]/N=C(C)/C(=N\[H])C(N)=O.
What is the InChIKey of 2,3-diiminobutanamide?
The InChIKey is NTQJFJPBXPVGNI-BUSIMMOISA-N. The full InChI is InChI=1S/C4H7N3O/c1-2(5)3(6)4(7)8/h5-6H,1H3,(H2,7,8)/b5-2+,6-3+.
What are the key properties of 2,3-diiminobutanamide?
2,3-diiminobutanamide has a molecular weight of 113.12 g/mol, XLogP of -0.47, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diiminobutanamide is sourced from PubChem (CID 55289896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).