About trans-(1R,3S)-1,2,2,3-tetramethylcyclopentan-1-amine
trans-(1R,3S)-1,2,2,3-tetramethylcyclopentan-1-amine (PubChem CID 55289923) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is trans-(1R,3S)-1,2,2,3-tetramethylcyclopentan-1-amine.
Analyze trans-(1R,3S)-1,2,2,3-tetramethylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,3S)-1,2,2,3-tetramethylcyclopentan-1-amine?
The IUPAC name of trans-(1R,3S)-1,2,2,3-tetramethylcyclopentan-1-amine (CID 55289923) is trans-(1R,3S)-1,2,2,3-tetramethylcyclopentan-1-amine.
What is the SMILES notation for trans-(1R,3S)-1,2,2,3-tetramethylcyclopentan-1-amine?
The canonical SMILES for trans-(1R,3S)-1,2,2,3-tetramethylcyclopentan-1-amine is C[C@H]1CC[C@@](C)(N)C1(C)C.
What is the InChIKey of trans-(1R,3S)-1,2,2,3-tetramethylcyclopentan-1-amine?
The InChIKey is FCXBGDZPQCTUAV-IONNQARKSA-N. The full InChI is InChI=1S/C9H19N/c1-7-5-6-9(4,10)8(7,2)3/h7H,5-6,10H2,1-4H3/t7-,9+/m0/s1.
What are the key properties of trans-(1R,3S)-1,2,2,3-tetramethylcyclopentan-1-amine?
trans-(1R,3S)-1,2,2,3-tetramethylcyclopentan-1-amine has a molecular weight of 141.26 g/mol, XLogP of 2.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,3S)-1,2,2,3-tetramethylcyclopentan-1-amine is sourced from PubChem (CID 55289923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).