About 3-hydrazinylpropanamide
3-hydrazinylpropanamide (PubChem CID 55289979) has the molecular formula C3H9N3O
and a molecular weight of 103.12 g/mol. Its IUPAC name is 3-hydrazinylpropanamide.
Molecular Properties
| Compound Name | 3-hydrazinylpropanamide |
| PubChem CID | 55289979 |
| Molecular Formula | C3H9N3O |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.07 |
| IUPAC Name | 3-hydrazinylpropanamide |
| SMILES | NNCCC(N)=O |
| InChI | InChI=1S/C3H9N3O/c4-3(7)1-2-6-5/h6H,1-2,5H2,(H2,4,7) |
| InChIKey | STBNDRFVFXHSEO-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydrazinylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydrazinylpropanamide?
The IUPAC name of 3-hydrazinylpropanamide (CID 55289979) is 3-hydrazinylpropanamide.
What is the SMILES notation for 3-hydrazinylpropanamide?
The canonical SMILES for 3-hydrazinylpropanamide is NNCCC(N)=O.
What is the InChIKey of 3-hydrazinylpropanamide?
The InChIKey is STBNDRFVFXHSEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N3O/c4-3(7)1-2-6-5/h6H,1-2,5H2,(H2,4,7).
What are the key properties of 3-hydrazinylpropanamide?
3-hydrazinylpropanamide has a molecular weight of 103.12 g/mol, XLogP of -1.67, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydrazinylpropanamide is sourced from PubChem (CID 55289979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).