About 5-iminopyrrol-2-amine
5-iminopyrrol-2-amine (PubChem CID 55290025) has the molecular formula C4H5N3
and a molecular weight of 95.10 g/mol. Its IUPAC name is 5-iminopyrrol-2-amine.
Molecular Properties
| Compound Name | 5-iminopyrrol-2-amine |
| PubChem CID | 55290025 |
| Molecular Formula | C4H5N3 |
| Molecular Weight | 95.10 g/mol |
| Exact Mass | 95.05 |
| IUPAC Name | 5-iminopyrrol-2-amine |
| SMILES | [H]/N=C1\C=CC(N)=N1 |
| InChI | InChI=1S/C4H5N3/c5-3-1-2-4(6)7-3/h1-2H,(H3,5,6,7) |
| InChIKey | YTPCNCOVEFRSOV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.10 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-iminopyrrol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iminopyrrol-2-amine?
The IUPAC name of 5-iminopyrrol-2-amine (CID 55290025) is 5-iminopyrrol-2-amine.
What is the SMILES notation for 5-iminopyrrol-2-amine?
The canonical SMILES for 5-iminopyrrol-2-amine is [H]/N=C1\C=CC(N)=N1.
What is the InChIKey of 5-iminopyrrol-2-amine?
The InChIKey is YTPCNCOVEFRSOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3/c5-3-1-2-4(6)7-3/h1-2H,(H3,5,6,7).
What are the key properties of 5-iminopyrrol-2-amine?
5-iminopyrrol-2-amine has a molecular weight of 95.10 g/mol, XLogP of -0.11, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iminopyrrol-2-amine is sourced from PubChem (CID 55290025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).