About 5-amino-2,4-dimethylbenzonitrile
5-amino-2,4-dimethylbenzonitrile (PubChem CID 55290114) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 5-amino-2,4-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 5-amino-2,4-dimethylbenzonitrile |
| PubChem CID | 55290114 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 5-amino-2,4-dimethylbenzonitrile |
| SMILES | Cc1cc(C)c(C#N)cc1N |
| InChI | InChI=1S/C9H10N2/c1-6-3-7(2)9(11)4-8(6)5-10/h3-4H,11H2,1-2H3 |
| InChIKey | HZFCDUZHYMJUMQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,4-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,4-dimethylbenzonitrile?
The IUPAC name of 5-amino-2,4-dimethylbenzonitrile (CID 55290114) is 5-amino-2,4-dimethylbenzonitrile.
What is the SMILES notation for 5-amino-2,4-dimethylbenzonitrile?
The canonical SMILES for 5-amino-2,4-dimethylbenzonitrile is Cc1cc(C)c(C#N)cc1N.
What is the InChIKey of 5-amino-2,4-dimethylbenzonitrile?
The InChIKey is HZFCDUZHYMJUMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-6-3-7(2)9(11)4-8(6)5-10/h3-4H,11H2,1-2H3.
What are the key properties of 5-amino-2,4-dimethylbenzonitrile?
5-amino-2,4-dimethylbenzonitrile has a molecular weight of 146.19 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,4-dimethylbenzonitrile is sourced from PubChem (CID 55290114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).